C26H33N3O3S — CID 100771765
1-[1-(3,4-dimethoxyphenyl)cyclopentyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea (PubChem CID 100771765) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)cyclopentyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)cyclopentyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100771765 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)cyclopentyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea |
| SMILES | COc1ccc(C2(NC(=S)Nc3ccc(C(=O)N4CCCCC4)cc3)CCCC2)cc1OC |
| InChI | InChI=1S/C26H33N3O3S/c1-31-22-13-10-20(18-23(22)32-2)26(14-4-5-15-26)28-25(33)27-21-11-8-19(9-12-21)24(30)29-16-6-3-7-17-29/h8-13,18H,3-7,14-17H2,1-2H3,(H2,27,28,33) |
| InChIKey | KYZFVVMHGCRIHP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|