C17H20N2OS2 — CID 100766082
1-(3-methoxyphenyl)-3-(1-thiophen-2-ylcyclopentyl)thiourea (PubChem CID 100766082) has the molecular formula C17H20N2OS2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-(1-thiophen-2-ylcyclopentyl)thiourea.
| Compound Name | 1-(3-methoxyphenyl)-3-(1-thiophen-2-ylcyclopentyl)thiourea |
|---|---|
| PubChem CID | 100766082 |
| Molecular Formula | C17H20N2OS2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-(1-thiophen-2-ylcyclopentyl)thiourea |
| SMILES | COc1cccc(NC(=S)NC2(c3cccs3)CCCC2)c1 |
| InChI | InChI=1S/C17H20N2OS2/c1-20-14-7-4-6-13(12-14)18-16(21)19-17(9-2-3-10-17)15-8-5-11-22-15/h4-8,11-12H,2-3,9-10H2,1H3,(H2,18,19,21) |
| InChIKey | UVODVXGMMAQIBZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|