C23H28N2OS — CID 100771317
1-[1-(2-phenylethyl)cyclopentyl]-3-(3-prop-2-enoxyphenyl)thiourea (PubChem CID 100771317) has the molecular formula C23H28N2OS and a molecular weight of 380.56 g/mol. Its IUPAC name is 1-[1-(2-phenylethyl)cyclopentyl]-3-(3-prop-2-enoxyphenyl)thiourea.
| Compound Name | 1-[1-(2-phenylethyl)cyclopentyl]-3-(3-prop-2-enoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100771317 |
| Molecular Formula | C23H28N2OS |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 1-[1-(2-phenylethyl)cyclopentyl]-3-(3-prop-2-enoxyphenyl)thiourea |
| SMILES | C=CCOc1cccc(NC(=S)NC2(CCc3ccccc3)CCCC2)c1 |
| InChI | InChI=1S/C23H28N2OS/c1-2-17-26-21-12-8-11-20(18-21)24-22(27)25-23(14-6-7-15-23)16-13-19-9-4-3-5-10-19/h2-5,8-12,18H,1,6-7,13-17H2,(H2,24,25,27) |
| InChIKey | BAUWSVVVIDSWTB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|