C21H26N2OS — CID 100705513
1-[(2R)-2-benzylbutyl]-3-(3-prop-2-enoxyphenyl)thiourea (PubChem CID 100705513) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is 1-[(2R)-2-benzylbutyl]-3-(3-prop-2-enoxyphenyl)thiourea.
| Compound Name | 1-[(2R)-2-benzylbutyl]-3-(3-prop-2-enoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100705513 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-[(2R)-2-benzylbutyl]-3-(3-prop-2-enoxyphenyl)thiourea |
| SMILES | C=CCOc1cccc(NC(=S)NC[C@H](CC)Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H26N2OS/c1-3-13-24-20-12-8-11-19(15-20)23-21(25)22-16-17(4-2)14-18-9-6-5-7-10-18/h3,5-12,15,17H,1,4,13-14,16H2,2H3,(H2,22,23,25)/t17-/m1/s1 |
| InChIKey | MQRRRIRNXVAFJM-QGZVFWFLSA-N |
| XLogP | 4.81 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|