C22H24ClF3N2S — CID 100768031
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[1-[2-(3-methylphenyl)ethyl]cyclopentyl]thiourea (PubChem CID 100768031) has the molecular formula C22H24ClF3N2S and a molecular weight of 440.96 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[1-[2-(3-methylphenyl)ethyl]cyclopentyl]thiourea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[1-[2-(3-methylphenyl)ethyl]cyclopentyl]thiourea |
|---|---|
| PubChem CID | 100768031 |
| Molecular Formula | C22H24ClF3N2S |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[1-[2-(3-methylphenyl)ethyl]cyclopentyl]thiourea |
| SMILES | Cc1cccc(CCC2(NC(=S)Nc3ccc(Cl)c(C(F)(F)F)c3)CCCC2)c1 |
| InChI | InChI=1S/C22H24ClF3N2S/c1-15-5-4-6-16(13-15)9-12-21(10-2-3-11-21)28-20(29)27-17-7-8-19(23)18(14-17)22(24,25)26/h4-8,13-14H,2-3,9-12H2,1H3,(H2,27,28,29) |
| InChIKey | OJDBNOUPVXAADF-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|