C20H16BrN5O2S — CID 100761155
1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(8-methoxyquinolin-5-yl)thiourea (PubChem CID 100761155) has the molecular formula C20H16BrN5O2S and a molecular weight of 470.35 g/mol. Its IUPAC name is 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(8-methoxyquinolin-5-yl)thiourea.
| Compound Name | 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(8-methoxyquinolin-5-yl)thiourea |
|---|---|
| PubChem CID | 100761155 |
| Molecular Formula | C20H16BrN5O2S |
| Molecular Weight | 470.35 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(8-methoxyquinolin-5-yl)thiourea |
| SMILES | COc1ccc(NC(=S)NCc2nc(-c3cccc(Br)c3)no2)c2cccnc12 |
| InChI | InChI=1S/C20H16BrN5O2S/c1-27-16-8-7-15(14-6-3-9-22-18(14)16)24-20(29)23-11-17-25-19(26-28-17)12-4-2-5-13(21)10-12/h2-10H,11H2,1H3,(H2,23,24,29) |
| InChIKey | ZKDCAOKDCCKZGP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|