C17H19BrN2O3S — CID 100666392
1-(4-bromophenyl)-3-[(2,3,4-trimethoxyphenyl)methyl]thiourea (PubChem CID 100666392) has the molecular formula C17H19BrN2O3S and a molecular weight of 411.32 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(2,3,4-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[(2,3,4-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100666392 |
| Molecular Formula | C17H19BrN2O3S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(2,3,4-trimethoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)Nc2ccc(Br)cc2)c(OC)c1OC |
| InChI | InChI=1S/C17H19BrN2O3S/c1-21-14-9-4-11(15(22-2)16(14)23-3)10-19-17(24)20-13-7-5-12(18)6-8-13/h4-9H,10H2,1-3H3,(H2,19,20,24) |
| InChIKey | ZTZGWOLKHGDZQW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|