C14H11BrCl2N2S — CID 19649583
1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]thiourea (PubChem CID 19649583) has the molecular formula C14H11BrCl2N2S and a molecular weight of 390.13 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 19649583 |
| Molecular Formula | C14H11BrCl2N2S |
| Molecular Weight | 390.13 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]thiourea |
| SMILES | S=C(NCc1ccc(Cl)cc1Cl)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H11BrCl2N2S/c15-10-2-5-12(6-3-10)19-14(20)18-8-9-1-4-11(16)7-13(9)17/h1-7H,8H2,(H2,18,19,20) |
| InChIKey | BHQPHNQZCMBAPO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.13 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|