C18H20BrNO7 — CID 171154855
4-bromo-N-[(2,3,4-trimethoxyphenyl)methyl]aniline;oxalic acid (PubChem CID 171154855) has the molecular formula C18H20BrNO7 and a molecular weight of 442.26 g/mol. Its IUPAC name is 4-bromo-N-[(2,3,4-trimethoxyphenyl)methyl]aniline;oxalic acid.
| Compound Name | 4-bromo-N-[(2,3,4-trimethoxyphenyl)methyl]aniline;oxalic acid |
|---|---|
| PubChem CID | 171154855 |
| Molecular Formula | C18H20BrNO7 |
| Molecular Weight | 442.26 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 4-bromo-N-[(2,3,4-trimethoxyphenyl)methyl]aniline;oxalic acid |
| SMILES | COc1ccc(CNc2ccc(Br)cc2)c(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H18BrNO3.C2H2O4/c1-19-14-9-4-11(15(20-2)16(14)21-3)10-18-13-7-5-12(17)6-8-13;3-1(4)2(5)6/h4-9,18H,10H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | YDJFAGMDYKBQKU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|