C15H17BrN2O3 — CID 75372885
5-bromo-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-2-amine (PubChem CID 75372885) has the molecular formula C15H17BrN2O3 and a molecular weight of 353.22 g/mol. Its IUPAC name is 5-bromo-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-2-amine.
| Compound Name | 5-bromo-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 75372885 |
| Molecular Formula | C15H17BrN2O3 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 5-bromo-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-2-amine |
| SMILES | COc1ccc(CNc2ccc(Br)cn2)c(OC)c1OC |
| InChI | InChI=1S/C15H17BrN2O3/c1-19-12-6-4-10(14(20-2)15(12)21-3)8-17-13-7-5-11(16)9-18-13/h4-7,9H,8H2,1-3H3,(H,17,18) |
| InChIKey | LTHRFCLAJKTSHK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |