C17H17BrN2O8 — CID 163326602
4-bromo-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]aniline;oxalic acid (PubChem CID 163326602) has the molecular formula C17H17BrN2O8 and a molecular weight of 457.23 g/mol. Its IUPAC name is 4-bromo-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]aniline;oxalic acid.
| Compound Name | 4-bromo-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]aniline;oxalic acid |
|---|---|
| PubChem CID | 163326602 |
| Molecular Formula | C17H17BrN2O8 |
| Molecular Weight | 457.23 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 4-bromo-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]aniline;oxalic acid |
| SMILES | COc1cc(CNc2ccc(Br)cc2)c([N+](=O)[O-])cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H15BrN2O4.C2H2O4/c1-21-14-7-10(13(18(19)20)8-15(14)22-2)9-17-12-5-3-11(16)4-6-12;3-1(4)2(5)6/h3-8,17H,9H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | UMSUKIBGAMRQPA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|