C17H17Br2NO6 — CID 17367909
4-bromo-N-[(5-bromo-2,4-dimethoxyphenyl)methyl]aniline;oxalic acid (PubChem CID 17367909) has the molecular formula C17H17Br2NO6 and a molecular weight of 491.13 g/mol. Its IUPAC name is 4-bromo-N-[(5-bromo-2,4-dimethoxyphenyl)methyl]aniline;oxalic acid.
| Compound Name | 4-bromo-N-[(5-bromo-2,4-dimethoxyphenyl)methyl]aniline;oxalic acid |
|---|---|
| PubChem CID | 17367909 |
| Molecular Formula | C17H17Br2NO6 |
| Molecular Weight | 491.13 g/mol |
| Exact Mass | 488.94 |
| IUPAC Name | 4-bromo-N-[(5-bromo-2,4-dimethoxyphenyl)methyl]aniline;oxalic acid |
| SMILES | COc1cc(OC)c(CNc2ccc(Br)cc2)cc1Br.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H15Br2NO2.C2H2O4/c1-19-14-8-15(20-2)13(17)7-10(14)9-18-12-5-3-11(16)4-6-12;3-1(4)2(5)6/h3-8,18H,9H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | UNJNUPKDGDYPEF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.13 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|