C16H15BrF3NO3 — CID 3424882
N-[(5-bromo-2,4-dimethoxyphenyl)methyl]-4-(trifluoromethoxy)aniline (PubChem CID 3424882) has the molecular formula C16H15BrF3NO3 and a molecular weight of 406.20 g/mol. Its IUPAC name is N-[(5-bromo-2,4-dimethoxyphenyl)methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-[(5-bromo-2,4-dimethoxyphenyl)methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 3424882 |
| Molecular Formula | C16H15BrF3NO3 |
| Molecular Weight | 406.20 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | N-[(5-bromo-2,4-dimethoxyphenyl)methyl]-4-(trifluoromethoxy)aniline |
| SMILES | COc1cc(OC)c(CNc2ccc(OC(F)(F)F)cc2)cc1Br |
| InChI | InChI=1S/C16H15BrF3NO3/c1-22-14-8-15(23-2)13(17)7-10(14)9-21-11-3-5-12(6-4-11)24-16(18,19)20/h3-8,21H,9H2,1-2H3 |
| InChIKey | YHTIZTGSEQVMJT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.20 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|