C18H16F3N3O4 — CID 51252631
N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(trifluoromethoxy)aniline (PubChem CID 51252631) has the molecular formula C18H16F3N3O4 and a molecular weight of 395.34 g/mol. Its IUPAC name is N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 51252631 |
| Molecular Formula | C18H16F3N3O4 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(trifluoromethoxy)aniline |
| SMILES | COc1ccc(-c2noc(CNc3ccc(OC(F)(F)F)cc3)n2)c(OC)c1 |
| InChI | InChI=1S/C18H16F3N3O4/c1-25-13-7-8-14(15(9-13)26-2)17-23-16(28-24-17)10-22-11-3-5-12(6-4-11)27-18(19,20)21/h3-9,22H,10H2,1-2H3 |
| InChIKey | JZWSRFWZKSULGO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|