C16H16BrNO4 — CID 1378416
N-[(5-bromo-2,4-dimethoxyphenyl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 1378416) has the molecular formula C16H16BrNO4 and a molecular weight of 366.21 g/mol. Its IUPAC name is N-[(5-bromo-2,4-dimethoxyphenyl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[(5-bromo-2,4-dimethoxyphenyl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 1378416 |
| Molecular Formula | C16H16BrNO4 |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | N-[(5-bromo-2,4-dimethoxyphenyl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | COc1cc(OC)c(CNc2ccc3c(c2)OCO3)cc1Br |
| InChI | InChI=1S/C16H16BrNO4/c1-19-14-7-15(20-2)12(17)5-10(14)8-18-11-3-4-13-16(6-11)22-9-21-13/h3-7,18H,8-9H2,1-2H3 |
| InChIKey | XMRQQNSIGGWIKP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|