C24H23BrN2O5 — CID 66543477
2-[2-[(1,3-benzodioxol-5-ylamino)methyl]-3-bromo-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 66543477) has the molecular formula C24H23BrN2O5 and a molecular weight of 499.36 g/mol. Its IUPAC name is 2-[2-[(1,3-benzodioxol-5-ylamino)methyl]-3-bromo-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-[(1,3-benzodioxol-5-ylamino)methyl]-3-bromo-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 66543477 |
| Molecular Formula | C24H23BrN2O5 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 2-[2-[(1,3-benzodioxol-5-ylamino)methyl]-3-bromo-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1ccc(Br)c(CNc2ccc3c(c2)OCO3)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C24H23BrN2O5/c1-15-3-5-16(6-4-15)27-23(28)13-30-24-18(19(25)8-10-21(24)29-2)12-26-17-7-9-20-22(11-17)32-14-31-20/h3-11,26H,12-14H2,1-2H3,(H,27,28) |
| InChIKey | BDSHRHFQSFCMHN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|