C17H18BrNO4 — CID 66543626
N-[(6-bromo-2,3-dimethoxyphenyl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 66543626) has the molecular formula C17H18BrNO4 and a molecular weight of 380.24 g/mol. Its IUPAC name is N-[(6-bromo-2,3-dimethoxyphenyl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[(6-bromo-2,3-dimethoxyphenyl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 66543626 |
| Molecular Formula | C17H18BrNO4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[(6-bromo-2,3-dimethoxyphenyl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | COc1ccc(Br)c(CNc2ccc3c(c2)OCCO3)c1OC |
| InChI | InChI=1S/C17H18BrNO4/c1-20-15-6-4-13(18)12(17(15)21-2)10-19-11-3-5-14-16(9-11)23-8-7-22-14/h3-6,9,19H,7-8,10H2,1-2H3 |
| InChIKey | QDIWMKGIMNYEOM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|