C16H17BrClNO3 — CID 66543602
N-[(6-bromo-2,3-dimethoxyphenyl)methyl]-3-chloro-4-methoxyaniline (PubChem CID 66543602) has the molecular formula C16H17BrClNO3 and a molecular weight of 386.67 g/mol. Its IUPAC name is N-[(6-bromo-2,3-dimethoxyphenyl)methyl]-3-chloro-4-methoxyaniline.
| Compound Name | N-[(6-bromo-2,3-dimethoxyphenyl)methyl]-3-chloro-4-methoxyaniline |
|---|---|
| PubChem CID | 66543602 |
| Molecular Formula | C16H17BrClNO3 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | N-[(6-bromo-2,3-dimethoxyphenyl)methyl]-3-chloro-4-methoxyaniline |
| SMILES | COc1ccc(NCc2c(Br)ccc(OC)c2OC)cc1Cl |
| InChI | InChI=1S/C16H17BrClNO3/c1-20-14-6-4-10(8-13(14)18)19-9-11-12(17)5-7-15(21-2)16(11)22-3/h4-8,19H,9H2,1-3H3 |
| InChIKey | KOEYPOAJAYNZPH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|