C26H27BrCl2N2O2 — CID 66544265
N-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-chloro-4-piperidin-1-ylaniline (PubChem CID 66544265) has the molecular formula C26H27BrCl2N2O2 and a molecular weight of 550.32 g/mol. Its IUPAC name is N-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-chloro-4-piperidin-1-ylaniline.
| Compound Name | N-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-chloro-4-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 66544265 |
| Molecular Formula | C26H27BrCl2N2O2 |
| Molecular Weight | 550.32 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | N-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-chloro-4-piperidin-1-ylaniline |
| SMILES | COc1ccc(Br)c(CNc2ccc(N3CCCCC3)c(Cl)c2)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27BrCl2N2O2/c1-32-25-12-10-22(27)21(26(25)33-17-18-5-7-19(28)8-6-18)16-30-20-9-11-24(23(29)15-20)31-13-3-2-4-14-31/h5-12,15,30H,2-4,13-14,16-17H2,1H3 |
| InChIKey | UNRVILBUGLLIEQ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.32 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|