C25H25BrCl2N2O3 — CID 66543864
N-[[6-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-morpholin-4-ylaniline (PubChem CID 66543864) has the molecular formula C25H25BrCl2N2O3 and a molecular weight of 552.30 g/mol. Its IUPAC name is N-[[6-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-morpholin-4-ylaniline.
| Compound Name | N-[[6-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 66543864 |
| Molecular Formula | C25H25BrCl2N2O3 |
| Molecular Weight | 552.30 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | N-[[6-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-morpholin-4-ylaniline |
| SMILES | COc1ccc(Br)c(CNc2ccc(N3CCOCC3)cc2)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H25BrCl2N2O3/c1-31-24-9-8-22(26)21(25(24)33-16-17-2-3-18(27)14-23(17)28)15-29-19-4-6-20(7-5-19)30-10-12-32-13-11-30/h2-9,14,29H,10-13,15-16H2,1H3 |
| InChIKey | YBKHDNPITRVVHV-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.30 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|