C25H27BrN2O3 — CID 66543268
N-[(6-bromo-3-methoxy-2-phenylmethoxyphenyl)methyl]-4-morpholin-4-ylaniline (PubChem CID 66543268) has the molecular formula C25H27BrN2O3 and a molecular weight of 483.41 g/mol. Its IUPAC name is N-[(6-bromo-3-methoxy-2-phenylmethoxyphenyl)methyl]-4-morpholin-4-ylaniline.
| Compound Name | N-[(6-bromo-3-methoxy-2-phenylmethoxyphenyl)methyl]-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 66543268 |
| Molecular Formula | C25H27BrN2O3 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | N-[(6-bromo-3-methoxy-2-phenylmethoxyphenyl)methyl]-4-morpholin-4-ylaniline |
| SMILES | COc1ccc(Br)c(CNc2ccc(N3CCOCC3)cc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H27BrN2O3/c1-29-24-12-11-23(26)22(25(24)31-18-19-5-3-2-4-6-19)17-27-20-7-9-21(10-8-20)28-13-15-30-16-14-28/h2-12,27H,13-18H2,1H3 |
| InChIKey | NXGGMKWLKSSTAN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|