C25H24BrCl2FN2O3 — CID 66543495
N-[[6-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-chloro-4-morpholin-4-ylaniline (PubChem CID 66543495) has the molecular formula C25H24BrCl2FN2O3 and a molecular weight of 570.29 g/mol. Its IUPAC name is N-[[6-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-chloro-4-morpholin-4-ylaniline.
| Compound Name | N-[[6-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-chloro-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 66543495 |
| Molecular Formula | C25H24BrCl2FN2O3 |
| Molecular Weight | 570.29 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | N-[[6-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-chloro-4-morpholin-4-ylaniline |
| SMILES | COc1ccc(Br)c(CNc2ccc(N3CCOCC3)c(Cl)c2)c1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C25H24BrCl2FN2O3/c1-32-24-8-6-19(26)17(25(24)34-15-18-20(27)3-2-4-22(18)29)14-30-16-5-7-23(21(28)13-16)31-9-11-33-12-10-31/h2-8,13,30H,9-12,14-15H2,1H3 |
| InChIKey | GCDJCPFTJZFRDE-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.29 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|