C26H26BrCl3N2O2 — CID 66543276
N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-chloro-4-piperidin-1-ylaniline (PubChem CID 66543276) has the molecular formula C26H26BrCl3N2O2 and a molecular weight of 584.77 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-chloro-4-piperidin-1-ylaniline.
| Compound Name | N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-chloro-4-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 66543276 |
| Molecular Formula | C26H26BrCl3N2O2 |
| Molecular Weight | 584.77 g/mol |
| Exact Mass | 582.02 |
| IUPAC Name | N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-chloro-4-piperidin-1-ylaniline |
| SMILES | COc1cc(CNc2ccc(N3CCCCC3)c(Cl)c2)c(Br)cc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H26BrCl3N2O2/c1-33-25-12-17(20(27)14-26(25)34-16-19-21(28)6-5-7-22(19)29)15-31-18-8-9-24(23(30)13-18)32-10-3-2-4-11-32/h5-9,12-14,31H,2-4,10-11,15-16H2,1H3 |
| InChIKey | LPRZWXVSWCVLEW-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.77 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|