C27H30BrClN2O2 — CID 66544365
N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-3-chloro-4-piperidin-1-ylaniline (PubChem CID 66544365) has the molecular formula C27H30BrClN2O2 and a molecular weight of 529.91 g/mol. Its IUPAC name is N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-3-chloro-4-piperidin-1-ylaniline.
| Compound Name | N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-3-chloro-4-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 66544365 |
| Molecular Formula | C27H30BrClN2O2 |
| Molecular Weight | 529.91 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-3-chloro-4-piperidin-1-ylaniline |
| SMILES | COc1ccc(Br)c(CNc2ccc(N3CCCCC3)c(Cl)c2)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C27H30BrClN2O2/c1-19-7-6-8-20(15-19)18-33-27-22(23(28)10-12-26(27)32-2)17-30-21-9-11-25(24(29)16-21)31-13-4-3-5-14-31/h6-12,15-16,30H,3-5,13-14,17-18H2,1-2H3 |
| InChIKey | VAWYXEGHQYMJIU-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.91 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|