C17H18BrN5O2 — CID 66544175
N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-2H-tetrazol-5-amine (PubChem CID 66544175) has the molecular formula C17H18BrN5O2 and a molecular weight of 404.27 g/mol. Its IUPAC name is N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-2H-tetrazol-5-amine.
| Compound Name | N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 66544175 |
| Molecular Formula | C17H18BrN5O2 |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-2H-tetrazol-5-amine |
| SMILES | COc1ccc(Br)c(CNc2nn[nH]n2)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C17H18BrN5O2/c1-11-4-3-5-12(8-11)10-25-16-13(9-19-17-20-22-23-21-17)14(18)6-7-15(16)24-2/h3-8H,9-10H2,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | FLACUDWUYQILFT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |