C24H26BrNO2 — CID 66536162
N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-1-phenylethanamine (PubChem CID 66536162) has the molecular formula C24H26BrNO2 and a molecular weight of 440.38 g/mol. Its IUPAC name is N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-1-phenylethanamine.
| Compound Name | N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 66536162 |
| Molecular Formula | C24H26BrNO2 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-1-phenylethanamine |
| SMILES | COc1ccc(Br)c(CNC(C)c2ccccc2)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C24H26BrNO2/c1-17-8-7-9-19(14-17)16-28-24-21(22(25)12-13-23(24)27-3)15-26-18(2)20-10-5-4-6-11-20/h4-14,18,26H,15-16H2,1-3H3 |
| InChIKey | NJCJPGIUEWOIJY-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |