C26H30BrNO4 — CID 66536682
N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 66536682) has the molecular formula C26H30BrNO4 and a molecular weight of 500.43 g/mol. Its IUPAC name is N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 66536682 |
| Molecular Formula | C26H30BrNO4 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-[[6-bromo-3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | COc1ccc(CCNCc2c(Br)ccc(OC)c2OCc2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C26H30BrNO4/c1-18-6-5-7-20(14-18)17-32-26-21(22(27)9-11-24(26)30-3)16-28-13-12-19-8-10-23(29-2)25(15-19)31-4/h5-11,14-15,28H,12-13,16-17H2,1-4H3 |
| InChIKey | RWLZZZQINQSPIY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|