C21H28BrNO4 — CID 66537304
N-[(6-bromo-3-methoxy-2-propan-2-yloxyphenyl)methyl]-2-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 66537304) has the molecular formula C21H28BrNO4 and a molecular weight of 438.36 g/mol. Its IUPAC name is N-[(6-bromo-3-methoxy-2-propan-2-yloxyphenyl)methyl]-2-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | N-[(6-bromo-3-methoxy-2-propan-2-yloxyphenyl)methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 66537304 |
| Molecular Formula | C21H28BrNO4 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-[(6-bromo-3-methoxy-2-propan-2-yloxyphenyl)methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | COc1ccc(CCNCc2c(Br)ccc(OC)c2OC(C)C)cc1OC |
| InChI | InChI=1S/C21H28BrNO4/c1-14(2)27-21-16(17(22)7-9-19(21)25-4)13-23-11-10-15-6-8-18(24-3)20(12-15)26-5/h6-9,12,14,23H,10-11,13H2,1-5H3 |
| InChIKey | YFPGRRMYYFFCSW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|