C27H32ClNO4 — CID 66531293
N-[[2-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 66531293) has the molecular formula C27H32ClNO4 and a molecular weight of 470.01 g/mol. Its IUPAC name is N-[[2-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | N-[[2-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 66531293 |
| Molecular Formula | C27H32ClNO4 |
| Molecular Weight | 470.01 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[[2-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | CCOc1cc(CNCCc2ccc(OC)c(OC)c2)c(Cl)cc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C27H32ClNO4/c1-5-32-26-15-22(17-29-12-11-20-9-10-24(30-3)25(14-20)31-4)23(28)16-27(26)33-18-21-8-6-7-19(2)13-21/h6-10,13-16,29H,5,11-12,17-18H2,1-4H3 |
| InChIKey | XSDAYOARXDQLFP-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.01 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|