C23H33ClN2O2 — CID 66538020
N-[[2-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 66538020) has the molecular formula C23H33ClN2O2 and a molecular weight of 404.98 g/mol. Its IUPAC name is N-[[2-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[[2-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 66538020 |
| Molecular Formula | C23H33ClN2O2 |
| Molecular Weight | 404.98 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-[[2-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCOc1cc(CNCCN(CC)CC)c(Cl)cc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C23H33ClN2O2/c1-5-26(6-2)12-11-25-16-20-14-22(27-7-3)23(15-21(20)24)28-17-19-10-8-9-18(4)13-19/h8-10,13-15,25H,5-7,11-12,16-17H2,1-4H3 |
| InChIKey | CUXDQPMCWQGUKB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.98 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|