C24H34ClN3O3 — CID 66538127
2-[5-chloro-4-[[2-(diethylamino)ethylamino]methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 66538127) has the molecular formula C24H34ClN3O3 and a molecular weight of 448.01 g/mol. Its IUPAC name is 2-[5-chloro-4-[[2-(diethylamino)ethylamino]methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[5-chloro-4-[[2-(diethylamino)ethylamino]methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 66538127 |
| Molecular Formula | C24H34ClN3O3 |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2-[5-chloro-4-[[2-(diethylamino)ethylamino]methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(CNCCN(CC)CC)c(Cl)cc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C24H34ClN3O3/c1-5-28(6-2)13-12-26-16-19-14-22(30-7-3)23(15-21(19)25)31-17-24(29)27-20-10-8-18(4)9-11-20/h8-11,14-15,26H,5-7,12-13,16-17H2,1-4H3,(H,27,29) |
| InChIKey | IDTAHSFJJJKZLD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|