C23H32BrN3O3 — CID 66538727
2-[5-bromo-4-[[2-(diethylamino)ethylamino]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 66538727) has the molecular formula C23H32BrN3O3 and a molecular weight of 478.43 g/mol. Its IUPAC name is 2-[5-bromo-4-[[2-(diethylamino)ethylamino]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[5-bromo-4-[[2-(diethylamino)ethylamino]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 66538727 |
| Molecular Formula | C23H32BrN3O3 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 2-[5-bromo-4-[[2-(diethylamino)ethylamino]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCN(CC)CCNCc1cc(OC)c(OCC(=O)Nc2ccc(C)cc2)cc1Br |
| InChI | InChI=1S/C23H32BrN3O3/c1-5-27(6-2)12-11-25-15-18-13-21(29-4)22(14-20(18)24)30-16-23(28)26-19-9-7-17(3)8-10-19/h7-10,13-14,25H,5-6,11-12,15-16H2,1-4H3,(H,26,28) |
| InChIKey | PJDUJYPUYIOPGP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|