C16H27BrN2O2 — CID 103720726
N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N'-ethyl-N'-propylethane-1,2-diamine (PubChem CID 103720726) has the molecular formula C16H27BrN2O2 and a molecular weight of 359.31 g/mol. Its IUPAC name is N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N'-ethyl-N'-propylethane-1,2-diamine.
| Compound Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N'-ethyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 103720726 |
| Molecular Formula | C16H27BrN2O2 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N'-ethyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CC)CCNCc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C16H27BrN2O2/c1-5-8-19(6-2)9-7-18-12-13-10-15(20-3)16(21-4)11-14(13)17/h10-11,18H,5-9,12H2,1-4H3 |
| InChIKey | ORMBJMIPCAQZQJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|