C13H21BrN2O3 — CID 66538635
2-[2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]ethylamino]ethanol (PubChem CID 66538635) has the molecular formula C13H21BrN2O3 and a molecular weight of 333.23 g/mol. Its IUPAC name is 2-[2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]ethylamino]ethanol.
| Compound Name | 2-[2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]ethylamino]ethanol |
|---|---|
| PubChem CID | 66538635 |
| Molecular Formula | C13H21BrN2O3 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-[2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]ethylamino]ethanol |
| SMILES | COc1cc(Br)c(CNCCNCCO)cc1OC |
| InChI | InChI=1S/C13H21BrN2O3/c1-18-12-7-10(11(14)8-13(12)19-2)9-16-4-3-15-5-6-17/h7-8,15-17H,3-6,9H2,1-2H3 |
| InChIKey | QSSWUAVOZMEILR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|