C19H25BrN2O3 — CID 66538313
2-[2-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylamino]ethylamino]ethanol (PubChem CID 66538313) has the molecular formula C19H25BrN2O3 and a molecular weight of 409.32 g/mol. Its IUPAC name is 2-[2-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylamino]ethylamino]ethanol.
| Compound Name | 2-[2-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylamino]ethylamino]ethanol |
|---|---|
| PubChem CID | 66538313 |
| Molecular Formula | C19H25BrN2O3 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-[2-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylamino]ethylamino]ethanol |
| SMILES | COc1cc(CNCCNCCO)c(Br)cc1OCc1ccccc1 |
| InChI | InChI=1S/C19H25BrN2O3/c1-24-18-11-16(13-22-8-7-21-9-10-23)17(20)12-19(18)25-14-15-5-3-2-4-6-15/h2-6,11-12,21-23H,7-10,13-14H2,1H3 |
| InChIKey | PDTXZIOPTVEQLO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|