C23H24BrNO3 — CID 66534458
2-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylamino]-1-phenylethanol (PubChem CID 66534458) has the molecular formula C23H24BrNO3 and a molecular weight of 442.35 g/mol. Its IUPAC name is 2-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylamino]-1-phenylethanol.
| Compound Name | 2-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 66534458 |
| Molecular Formula | C23H24BrNO3 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 2-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylamino]-1-phenylethanol |
| SMILES | COc1cc(CNCC(O)c2ccccc2)c(Br)cc1OCc1ccccc1 |
| InChI | InChI=1S/C23H24BrNO3/c1-27-22-12-19(14-25-15-21(26)18-10-6-3-7-11-18)20(24)13-23(22)28-16-17-8-4-2-5-9-17/h2-13,21,25-26H,14-16H2,1H3 |
| InChIKey | DNQLXZCAALUPSH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |