C23H24BrNO2 — CID 51993677
(1R)-2-[[5-bromo-2-[(3-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol (PubChem CID 51993677) has the molecular formula C23H24BrNO2 and a molecular weight of 426.35 g/mol. Its IUPAC name is (1R)-2-[[5-bromo-2-[(3-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol.
| Compound Name | (1R)-2-[[5-bromo-2-[(3-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 51993677 |
| Molecular Formula | C23H24BrNO2 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | (1R)-2-[[5-bromo-2-[(3-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol |
| SMILES | Cc1cccc(COc2ccc(Br)cc2CNC[C@H](O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H24BrNO2/c1-17-6-5-7-18(12-17)16-27-23-11-10-21(24)13-20(23)14-25-15-22(26)19-8-3-2-4-9-19/h2-13,22,25-26H,14-16H2,1H3/t22-/m0/s1 |
| InChIKey | VBBNZODBSRAXGG-QFIPXVFZSA-N |
| XLogP | 5.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |