C23H25NO2 — CID 29186359
(1R)-2-[[2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol (PubChem CID 29186359) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (1R)-2-[[2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol.
| Compound Name | (1R)-2-[[2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 29186359 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (1R)-2-[[2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol |
| SMILES | Cc1ccc(COc2ccccc2CNC[C@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25NO2/c1-18-11-13-19(14-12-18)17-26-23-10-6-5-9-21(23)15-24-16-22(25)20-7-3-2-4-8-20/h2-14,22,24-25H,15-17H2,1H3/t22-/m0/s1 |
| InChIKey | JJLSSRIQKLLFEJ-QFIPXVFZSA-N |
| XLogP | 4.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |