C23H26ClNO2 — CID 17055126
2-[[3-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol;hydrochloride (PubChem CID 17055126) has the molecular formula C23H26ClNO2 and a molecular weight of 383.92 g/mol. Its IUPAC name is 2-[[3-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol;hydrochloride.
| Compound Name | 2-[[3-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol;hydrochloride |
|---|---|
| PubChem CID | 17055126 |
| Molecular Formula | C23H26ClNO2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-[[3-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol;hydrochloride |
| SMILES | Cc1ccc(COc2cccc(CNCC(O)c3ccccc3)c2)cc1.Cl |
| InChI | InChI=1S/C23H25NO2.ClH/c1-18-10-12-19(13-11-18)17-26-22-9-5-6-20(14-22)15-24-16-23(25)21-7-3-2-4-8-21;/h2-14,23-25H,15-17H2,1H3;1H |
| InChIKey | RFCWXIRFRMKKMH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |