C22H22FNO2 — CID 124700879
(1S)-1-(4-fluorophenyl)-2-[(3-phenylmethoxyphenyl)methylamino]ethanol (PubChem CID 124700879) has the molecular formula C22H22FNO2 and a molecular weight of 351.42 g/mol. Its IUPAC name is (1S)-1-(4-fluorophenyl)-2-[(3-phenylmethoxyphenyl)methylamino]ethanol.
| Compound Name | (1S)-1-(4-fluorophenyl)-2-[(3-phenylmethoxyphenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 124700879 |
| Molecular Formula | C22H22FNO2 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (1S)-1-(4-fluorophenyl)-2-[(3-phenylmethoxyphenyl)methylamino]ethanol |
| SMILES | O[C@H](CNCc1cccc(OCc2ccccc2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22FNO2/c23-20-11-9-19(10-12-20)22(25)15-24-14-18-7-4-8-21(13-18)26-16-17-5-2-1-3-6-17/h1-13,22,24-25H,14-16H2/t22-/m1/s1 |
| InChIKey | XPLAOEAHBSHWKN-JOCHJYFZSA-N |
| XLogP | 4.23 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |