C16H19ClFNO2 — CID 2950906
2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethanol;hydrochloride (PubChem CID 2950906) has the molecular formula C16H19ClFNO2 and a molecular weight of 311.78 g/mol. Its IUPAC name is 2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethanol;hydrochloride.
| Compound Name | 2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 2950906 |
| Molecular Formula | C16H19ClFNO2 |
| Molecular Weight | 311.78 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethanol;hydrochloride |
| SMILES | Cl.OCCNCc1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H18FNO2.ClH/c17-15-6-4-13(5-7-15)12-20-16-3-1-2-14(10-16)11-18-8-9-19;/h1-7,10,18-19H,8-9,11-12H2;1H |
| InChIKey | BAYPAZDUTWPFMW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.78 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|