C18H25Cl2FN2O2 — CID 17295166
2-[2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]ethanol;dihydrochloride (PubChem CID 17295166) has the molecular formula C18H25Cl2FN2O2 and a molecular weight of 391.31 g/mol. Its IUPAC name is 2-[2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]ethanol;dihydrochloride.
| Compound Name | 2-[2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 17295166 |
| Molecular Formula | C18H25Cl2FN2O2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-[2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]ethanol;dihydrochloride |
| SMILES | Cl.Cl.OCCNCCNCc1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H23FN2O2.2ClH/c19-17-6-4-15(5-7-17)14-23-18-3-1-2-16(12-18)13-21-9-8-20-10-11-22;;/h1-7,12,20-22H,8-11,13-14H2;2*1H |
| InChIKey | RVMVDWJIIBWNAE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|