C23H25BrClNO2 — CID 17055248
2-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol;hydrochloride (PubChem CID 17055248) has the molecular formula C23H25BrClNO2 and a molecular weight of 462.82 g/mol. Its IUPAC name is 2-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol;hydrochloride.
| Compound Name | 2-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol;hydrochloride |
|---|---|
| PubChem CID | 17055248 |
| Molecular Formula | C23H25BrClNO2 |
| Molecular Weight | 462.82 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylethanol;hydrochloride |
| SMILES | Cc1ccc(COc2ccc(Br)cc2CNCC(O)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C23H24BrNO2.ClH/c1-17-7-9-18(10-8-17)16-27-23-12-11-21(24)13-20(23)14-25-15-22(26)19-5-3-2-4-6-19;/h2-13,22,25-26H,14-16H2,1H3;1H |
| InChIKey | ODNVEFOPMHEDQD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.82 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |