C23H25NO3 — CID 46893592
(1R)-2-[(2-methoxyphenyl)methylamino]-1-(3-phenylmethoxyphenyl)ethanol (PubChem CID 46893592) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (1R)-2-[(2-methoxyphenyl)methylamino]-1-(3-phenylmethoxyphenyl)ethanol.
| Compound Name | (1R)-2-[(2-methoxyphenyl)methylamino]-1-(3-phenylmethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 46893592 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (1R)-2-[(2-methoxyphenyl)methylamino]-1-(3-phenylmethoxyphenyl)ethanol |
| SMILES | COc1ccccc1CNC[C@H](O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H25NO3/c1-26-23-13-6-5-10-20(23)15-24-16-22(25)19-11-7-12-21(14-19)27-17-18-8-3-2-4-9-18/h2-14,22,24-25H,15-17H2,1H3/t22-/m0/s1 |
| InChIKey | IUIQRJDMGWCAPX-QFIPXVFZSA-N |
| XLogP | 4.10 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |