C19H24BrNO3 — CID 66533959
2-[(2-bromo-4,5-diethoxyphenyl)methylamino]-1-phenylethanol (PubChem CID 66533959) has the molecular formula C19H24BrNO3 and a molecular weight of 394.31 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-diethoxyphenyl)methylamino]-1-phenylethanol.
| Compound Name | 2-[(2-bromo-4,5-diethoxyphenyl)methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 66533959 |
| Molecular Formula | C19H24BrNO3 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-[(2-bromo-4,5-diethoxyphenyl)methylamino]-1-phenylethanol |
| SMILES | CCOc1cc(Br)c(CNCC(O)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C19H24BrNO3/c1-3-23-18-10-15(16(20)11-19(18)24-4-2)12-21-13-17(22)14-8-6-5-7-9-14/h5-11,17,21-22H,3-4,12-13H2,1-2H3 |
| InChIKey | PQDLGYBBKLAGSW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |