C15H21BrN2O3 — CID 115572147
N-[2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]ethyl]cyclopropanecarboxamide (PubChem CID 115572147) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is N-[2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 115572147 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-[2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]ethyl]cyclopropanecarboxamide |
| SMILES | COc1cc(Br)c(CNCCNC(=O)C2CC2)cc1OC |
| InChI | InChI=1S/C15H21BrN2O3/c1-20-13-7-11(12(16)8-14(13)21-2)9-17-5-6-18-15(19)10-3-4-10/h7-8,10,17H,3-6,9H2,1-2H3,(H,18,19) |
| InChIKey | GFZRZUVLOCVFJW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|