C14H18Br2N2O2 — CID 47112268
N-[2-[(3,5-dibromo-2-methoxyphenyl)methylamino]ethyl]cyclopropanecarboxamide (PubChem CID 47112268) has the molecular formula C14H18Br2N2O2 and a molecular weight of 406.12 g/mol. Its IUPAC name is N-[2-[(3,5-dibromo-2-methoxyphenyl)methylamino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[(3,5-dibromo-2-methoxyphenyl)methylamino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 47112268 |
| Molecular Formula | C14H18Br2N2O2 |
| Molecular Weight | 406.12 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | N-[2-[(3,5-dibromo-2-methoxyphenyl)methylamino]ethyl]cyclopropanecarboxamide |
| SMILES | COc1c(Br)cc(Br)cc1CNCCNC(=O)C1CC1 |
| InChI | InChI=1S/C14H18Br2N2O2/c1-20-13-10(6-11(15)7-12(13)16)8-17-4-5-18-14(19)9-2-3-9/h6-7,9,17H,2-5,8H2,1H3,(H,18,19) |
| InChIKey | KISICDIZRGYPBI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.12 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|