C11H15Br2NO3 — CID 66176532
3-[(3,5-dibromo-2-methoxyphenyl)methylamino]propane-1,2-diol (PubChem CID 66176532) has the molecular formula C11H15Br2NO3 and a molecular weight of 369.05 g/mol. Its IUPAC name is 3-[(3,5-dibromo-2-methoxyphenyl)methylamino]propane-1,2-diol.
| Compound Name | 3-[(3,5-dibromo-2-methoxyphenyl)methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 66176532 |
| Molecular Formula | C11H15Br2NO3 |
| Molecular Weight | 369.05 g/mol |
| Exact Mass | 366.94 |
| IUPAC Name | 3-[(3,5-dibromo-2-methoxyphenyl)methylamino]propane-1,2-diol |
| SMILES | COc1c(Br)cc(Br)cc1CNCC(O)CO |
| InChI | InChI=1S/C11H15Br2NO3/c1-17-11-7(2-8(12)3-10(11)13)4-14-5-9(16)6-15/h2-3,9,14-16H,4-6H2,1H3 |
| InChIKey | FINYUBKJUDFKLW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.05 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |