C13H19Br2NO2 — CID 115644565
3-[(3,5-dibromo-2-methoxyphenyl)methylamino]-2-methylbutan-1-ol (PubChem CID 115644565) has the molecular formula C13H19Br2NO2 and a molecular weight of 381.11 g/mol. Its IUPAC name is 3-[(3,5-dibromo-2-methoxyphenyl)methylamino]-2-methylbutan-1-ol.
| Compound Name | 3-[(3,5-dibromo-2-methoxyphenyl)methylamino]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 115644565 |
| Molecular Formula | C13H19Br2NO2 |
| Molecular Weight | 381.11 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | 3-[(3,5-dibromo-2-methoxyphenyl)methylamino]-2-methylbutan-1-ol |
| SMILES | COc1c(Br)cc(Br)cc1CNC(C)C(C)CO |
| InChI | InChI=1S/C13H19Br2NO2/c1-8(7-17)9(2)16-6-10-4-11(14)5-12(15)13(10)18-3/h4-5,8-9,16-17H,6-7H2,1-3H3 |
| InChIKey | NVKAHMBBUDBCAR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.11 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |