C16H17Br2NO2 — CID 103766342
(2R)-2-[(3,5-dibromo-2-methoxyphenyl)methylamino]-2-phenylethanol (PubChem CID 103766342) has the molecular formula C16H17Br2NO2 and a molecular weight of 415.13 g/mol. Its IUPAC name is (2R)-2-[(3,5-dibromo-2-methoxyphenyl)methylamino]-2-phenylethanol.
| Compound Name | (2R)-2-[(3,5-dibromo-2-methoxyphenyl)methylamino]-2-phenylethanol |
|---|---|
| PubChem CID | 103766342 |
| Molecular Formula | C16H17Br2NO2 |
| Molecular Weight | 415.13 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | (2R)-2-[(3,5-dibromo-2-methoxyphenyl)methylamino]-2-phenylethanol |
| SMILES | COc1c(Br)cc(Br)cc1CN[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C16H17Br2NO2/c1-21-16-12(7-13(17)8-14(16)18)9-19-15(10-20)11-5-3-2-4-6-11/h2-8,15,19-20H,9-10H2,1H3/t15-/m0/s1 |
| InChIKey | WCEKMENKVFOZKA-HNNXBMFYSA-N |
| XLogP | 4.04 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.13 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |